C18H15F9N2O3 — CID 71310721
[(Z)-[cyano(phenyl)methylidene]amino] (5,5,6,6,7,7,8,8,8-nonafluoro-2-methyloctan-2-yl) carbonate (PubChem CID 71310721) has the molecular formula C18H15F9N2O3 and a molecular weight of 478.31 g/mol. Its IUPAC name is [(Z)-[cyano(phenyl)methylidene]amino] (5,5,6,6,7,7,8,8,8-nonafluoro-2-methyloctan-2-yl) carbonate.
| Compound Name | [(Z)-[cyano(phenyl)methylidene]amino] (5,5,6,6,7,7,8,8,8-nonafluoro-2-methyloctan-2-yl) carbonate |
|---|---|
| PubChem CID | 71310721 |
| Molecular Formula | C18H15F9N2O3 |
| Molecular Weight | 478.31 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | [(Z)-[cyano(phenyl)methylidene]amino] (5,5,6,6,7,7,8,8,8-nonafluoro-2-methyloctan-2-yl) carbonate |
| SMILES | CC(C)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC(=O)O/N=C(\C#N)c1ccccc1 |
| InChI | InChI=1S/C18H15F9N2O3/c1-14(2,8-9-15(19,20)16(21,22)17(23,24)18(25,26)27)31-13(30)32-29-12(10-28)11-6-4-3-5-7-11/h3-7H,8-9H2,1-2H3/b29-12+ |
| InChIKey | UVLBAEYPKCVCLV-XKJRVUDJSA-N |
| XLogP | 6.09 |
| TPSA | 71.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.31 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|