C25H20F18N2O3 — CID 11136380
[(Z)-[cyano(phenyl)methylidene]amino] (1,1,1,2,2,3,3,4,4,12,12,13,13,14,14,15,15,15-octadecafluoro-8-methylpentadecan-8-yl) carbonate (PubChem CID 11136380) has the molecular formula C25H20F18N2O3 and a molecular weight of 738.41 g/mol. Its IUPAC name is [(Z)-[cyano(phenyl)methylidene]amino] (1,1,1,2,2,3,3,4,4,12,12,13,13,14,14,15,15,15-octadecafluoro-8-methylpentadecan-8-yl) carbonate.
| Compound Name | [(Z)-[cyano(phenyl)methylidene]amino] (1,1,1,2,2,3,3,4,4,12,12,13,13,14,14,15,15,15-octadecafluoro-8-methylpentadecan-8-yl) carbonate |
|---|---|
| PubChem CID | 11136380 |
| Molecular Formula | C25H20F18N2O3 |
| Molecular Weight | 738.41 g/mol |
| Exact Mass | 738.12 |
| IUPAC Name | [(Z)-[cyano(phenyl)methylidene]amino] (1,1,1,2,2,3,3,4,4,12,12,13,13,14,14,15,15,15-octadecafluoro-8-methylpentadecan-8-yl) carbonate |
| SMILES | CC(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC(=O)O/N=C(\C#N)c1ccccc1 |
| InChI | InChI=1S/C25H20F18N2O3/c1-17(47-16(46)48-45-15(13-44)14-7-3-2-4-8-14,9-5-11-18(26,27)20(30,31)22(34,35)24(38,39)40)10-6-12-19(28,29)21(32,33)23(36,37)25(41,42)43/h2-4,7-8H,5-6,9-12H2,1H3/b45-15+ |
| InChIKey | DCVCZKIXUXLZKI-VVBBIQDTSA-N |
| XLogP | 10.10 |
| TPSA | 71.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.41 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|