C19H40O3Si5 — CID 175704291
(1-dimethylsilyl-2-phenylethenyl)-tris(trimethylsilyloxy)silane (PubChem CID 175704291) has the molecular formula C19H40O3Si5 and a molecular weight of 456.96 g/mol. Its IUPAC name is (1-dimethylsilyl-2-phenylethenyl)-tris(trimethylsilyloxy)silane.
| Compound Name | (1-dimethylsilyl-2-phenylethenyl)-tris(trimethylsilyloxy)silane |
|---|---|
| PubChem CID | 175704291 |
| Molecular Formula | C19H40O3Si5 |
| Molecular Weight | 456.96 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | (1-dimethylsilyl-2-phenylethenyl)-tris(trimethylsilyloxy)silane |
| SMILES | C[SiH](C)C(=Cc1ccccc1)[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C19H40O3Si5/c1-23(2)19(17-18-15-13-12-14-16-18)27(20-24(3,4)5,21-25(6,7)8)22-26(9,10)11/h12-17,23H,1-11H3 |
| InChIKey | JHWOHBXBZNDEIB-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.96 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|