C16H26Cl6NSbSi — CID 16687306
ethyl-ethylidene-[(Z)-3-phenyl-2-trimethylsilylprop-2-enyl]azanium;hexachloroantimony(1-) (PubChem CID 16687306) has the molecular formula C16H26Cl6NSbSi and a molecular weight of 594.96 g/mol. Its IUPAC name is ethyl-ethylidene-[(Z)-3-phenyl-2-trimethylsilylprop-2-enyl]azanium;hexachloroantimony(1-).
| Compound Name | ethyl-ethylidene-[(Z)-3-phenyl-2-trimethylsilylprop-2-enyl]azanium;hexachloroantimony(1-) |
|---|---|
| PubChem CID | 16687306 |
| Molecular Formula | C16H26Cl6NSbSi |
| Molecular Weight | 594.96 g/mol |
| Exact Mass | 590.90 |
| IUPAC Name | ethyl-ethylidene-[(Z)-3-phenyl-2-trimethylsilylprop-2-enyl]azanium;hexachloroantimony(1-) |
| SMILES | C/C=[N+](\CC)C/C(=C/c1ccccc1)[Si](C)(C)C.Cl[Sb-](Cl)(Cl)(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H26NSi.6ClH.Sb/c1-6-17(7-2)14-16(18(3,4)5)13-15-11-9-8-10-12-15;;;;;;;/h6,8-13H,7,14H2,1-5H3;6*1H;/q+1;;;;;;;+5/p-6/b16-13-,17-6+;;;;;;; |
| InChIKey | CTIIISUNYGKUEV-LPZZHFMYSA-H |
| XLogP | 7.83 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.96 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|