C18H30O2Si — CID 10804618
(E,3S,4R)-6-phenyl-4-triethylsilyloxyhex-5-en-3-ol (PubChem CID 10804618) has the molecular formula C18H30O2Si and a molecular weight of 306.52 g/mol. Its IUPAC name is (E,3S,4R)-6-phenyl-4-triethylsilyloxyhex-5-en-3-ol.
| Compound Name | (E,3S,4R)-6-phenyl-4-triethylsilyloxyhex-5-en-3-ol |
|---|---|
| PubChem CID | 10804618 |
| Molecular Formula | C18H30O2Si |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | (E,3S,4R)-6-phenyl-4-triethylsilyloxyhex-5-en-3-ol |
| SMILES | CC[C@H](O)[C@@H](/C=C/c1ccccc1)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C18H30O2Si/c1-5-17(19)18(20-21(6-2,7-3)8-4)15-14-16-12-10-9-11-13-16/h9-15,17-19H,5-8H2,1-4H3/b15-14+/t17-,18+/m0/s1 |
| InChIKey | AXOXCFBWPNIANW-KRWOKUGFSA-N |
| XLogP | 4.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|