C25H37NO3Si — CID 11683351
(E,2R,3R)-2-[(2S)-1-[(E)-but-2-enyl]-5-oxopyrrolidin-2-yl]-5-phenyl-3-triethylsilyloxypent-4-enal (PubChem CID 11683351) has the molecular formula C25H37NO3Si and a molecular weight of 427.66 g/mol. Its IUPAC name is (E,2R,3R)-2-[(2S)-1-[(E)-but-2-enyl]-5-oxopyrrolidin-2-yl]-5-phenyl-3-triethylsilyloxypent-4-enal.
| Compound Name | (E,2R,3R)-2-[(2S)-1-[(E)-but-2-enyl]-5-oxopyrrolidin-2-yl]-5-phenyl-3-triethylsilyloxypent-4-enal |
|---|---|
| PubChem CID | 11683351 |
| Molecular Formula | C25H37NO3Si |
| Molecular Weight | 427.66 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | (E,2R,3R)-2-[(2S)-1-[(E)-but-2-enyl]-5-oxopyrrolidin-2-yl]-5-phenyl-3-triethylsilyloxypent-4-enal |
| SMILES | C/C=C/CN1C(=O)CC[C@H]1[C@@H](C=O)[C@@H](/C=C/c1ccccc1)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C25H37NO3Si/c1-5-9-19-26-23(16-18-25(26)28)22(20-27)24(29-30(6-2,7-3)8-4)17-15-21-13-11-10-12-14-21/h5,9-15,17,20,22-24H,6-8,16,18-19H2,1-4H3/b9-5+,17-15+/t22-,23+,24-/m1/s1 |
| InChIKey | ZVUAKCHPTRBAAL-SQVVQQRPSA-N |
| XLogP | 5.47 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.66 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|