C19H21NO5 — CID 20612152
(2,5-dioxopyrrolidin-1-yl) (2E,7E)-5-hydroxy-6-methyl-8-phenylocta-2,7-dienoate (PubChem CID 20612152) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (2E,7E)-5-hydroxy-6-methyl-8-phenylocta-2,7-dienoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (2E,7E)-5-hydroxy-6-methyl-8-phenylocta-2,7-dienoate |
|---|---|
| PubChem CID | 20612152 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2E,7E)-5-hydroxy-6-methyl-8-phenylocta-2,7-dienoate |
| SMILES | CC(/C=C/c1ccccc1)C(O)C/C=C/C(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C19H21NO5/c1-14(10-11-15-6-3-2-4-7-15)16(21)8-5-9-19(24)25-20-17(22)12-13-18(20)23/h2-7,9-11,14,16,21H,8,12-13H2,1H3/b9-5+,11-10+ |
| InChIKey | UOBDUZGPQCTGDN-NJNCEADSSA-N |
| XLogP | 2.25 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|