C26H30O4 — CID 101225778
tert-butyl (2E,5S,6R,7E)-8-(4-benzoylphenyl)-5-hydroxy-6-methylocta-2,7-dienoate (PubChem CID 101225778) has the molecular formula C26H30O4 and a molecular weight of 406.52 g/mol. Its IUPAC name is tert-butyl (2E,5S,6R,7E)-8-(4-benzoylphenyl)-5-hydroxy-6-methylocta-2,7-dienoate.
| Compound Name | tert-butyl (2E,5S,6R,7E)-8-(4-benzoylphenyl)-5-hydroxy-6-methylocta-2,7-dienoate |
|---|---|
| PubChem CID | 101225778 |
| Molecular Formula | C26H30O4 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | tert-butyl (2E,5S,6R,7E)-8-(4-benzoylphenyl)-5-hydroxy-6-methylocta-2,7-dienoate |
| SMILES | C[C@H](/C=C/c1ccc(C(=O)c2ccccc2)cc1)[C@@H](O)C/C=C/C(=O)OC(C)(C)C |
| InChI | InChI=1S/C26H30O4/c1-19(23(27)11-8-12-24(28)30-26(2,3)4)13-14-20-15-17-22(18-16-20)25(29)21-9-6-5-7-10-21/h5-10,12-19,23,27H,11H2,1-4H3/b12-8+,14-13+/t19-,23+/m1/s1 |
| InChIKey | MEYDWRUOWRJWSM-AKNVRPIMSA-N |
| XLogP | 5.22 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|