C19H21NO5 — CID 54309711
(2,5-dihydroxypyrrol-1-yl) (5S,6R)-5-hydroxy-6-methyl-8-phenylocta-2,7-dienoate (PubChem CID 54309711) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) (5S,6R)-5-hydroxy-6-methyl-8-phenylocta-2,7-dienoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) (5S,6R)-5-hydroxy-6-methyl-8-phenylocta-2,7-dienoate |
|---|---|
| PubChem CID | 54309711 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) (5S,6R)-5-hydroxy-6-methyl-8-phenylocta-2,7-dienoate |
| SMILES | C[C@H](C=Cc1ccccc1)[C@@H](O)CC=CC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C19H21NO5/c1-14(10-11-15-6-3-2-4-7-15)16(21)8-5-9-19(24)25-20-17(22)12-13-18(20)23/h2-7,9-14,16,21-23H,8H2,1H3/t14-,16+/m1/s1 |
| InChIKey | SKAPHTILCNHYBV-ZBFHGGJFSA-N |
| XLogP | 2.51 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|