C19H24O2 — CID 155728981
8-methylnona-1,6-dien-3-yl (E)-3-phenylprop-2-enoate (PubChem CID 155728981) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 8-methylnona-1,6-dien-3-yl (E)-3-phenylprop-2-enoate.
| Compound Name | 8-methylnona-1,6-dien-3-yl (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 155728981 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 8-methylnona-1,6-dien-3-yl (E)-3-phenylprop-2-enoate |
| SMILES | C=CC(CCC=CC(C)C)OC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H24O2/c1-4-18(13-9-8-10-16(2)3)21-19(20)15-14-17-11-6-5-7-12-17/h4-8,10-12,14-16,18H,1,9,13H2,2-3H3/b10-8?,15-14+ |
| InChIKey | VWVFEGFMEZDHMQ-KJPSGJCNSA-N |
| XLogP | 4.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|