C22H25NO3 — CID 46810097
[1-oxo-1-(1-phenylbutylamino)propan-2-yl] (E)-3-phenylprop-2-enoate (PubChem CID 46810097) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is [1-oxo-1-(1-phenylbutylamino)propan-2-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [1-oxo-1-(1-phenylbutylamino)propan-2-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 46810097 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | [1-oxo-1-(1-phenylbutylamino)propan-2-yl] (E)-3-phenylprop-2-enoate |
| SMILES | CCCC(NC(=O)C(C)OC(=O)/C=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25NO3/c1-3-10-20(19-13-8-5-9-14-19)23-22(25)17(2)26-21(24)16-15-18-11-6-4-7-12-18/h4-9,11-17,20H,3,10H2,1-2H3,(H,23,25)/b16-15+ |
| InChIKey | ZNUOBJDNEMWJBV-FOCLMDBBSA-N |
| XLogP | 4.29 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|