C20H26O4 — CID 129104586
tert-butyl (2E,7E)-8-(4-formylphenyl)-5-hydroxy-6-methylocta-2,7-dienoate (PubChem CID 129104586) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is tert-butyl (2E,7E)-8-(4-formylphenyl)-5-hydroxy-6-methylocta-2,7-dienoate.
| Compound Name | tert-butyl (2E,7E)-8-(4-formylphenyl)-5-hydroxy-6-methylocta-2,7-dienoate |
|---|---|
| PubChem CID | 129104586 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | tert-butyl (2E,7E)-8-(4-formylphenyl)-5-hydroxy-6-methylocta-2,7-dienoate |
| SMILES | CC(/C=C/c1ccc(C=O)cc1)C(O)C/C=C/C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H26O4/c1-15(8-9-16-10-12-17(14-21)13-11-16)18(22)6-5-7-19(23)24-20(2,3)4/h5,7-15,18,22H,6H2,1-4H3/b7-5+,9-8+ |
| InChIKey | OWWKPHCIJVIXDU-ZIRGRKGMSA-N |
| XLogP | 3.80 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|