C27H29Cl4NO5 — CID 59936723
2,2,2-trichloroethyl 3-(3-chloro-4-methoxyphenyl)-2-[[(2E,6R,7E)-5-hydroxy-6-methyl-8-phenylocta-2,7-dienoyl]amino]propanoate (PubChem CID 59936723) has the molecular formula C27H29Cl4NO5 and a molecular weight of 589.34 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 3-(3-chloro-4-methoxyphenyl)-2-[[(2E,6R,7E)-5-hydroxy-6-methyl-8-phenylocta-2,7-dienoyl]amino]propanoate.
| Compound Name | 2,2,2-trichloroethyl 3-(3-chloro-4-methoxyphenyl)-2-[[(2E,6R,7E)-5-hydroxy-6-methyl-8-phenylocta-2,7-dienoyl]amino]propanoate |
|---|---|
| PubChem CID | 59936723 |
| Molecular Formula | C27H29Cl4NO5 |
| Molecular Weight | 589.34 g/mol |
| Exact Mass | 587.08 |
| IUPAC Name | 2,2,2-trichloroethyl 3-(3-chloro-4-methoxyphenyl)-2-[[(2E,6R,7E)-5-hydroxy-6-methyl-8-phenylocta-2,7-dienoyl]amino]propanoate |
| SMILES | COc1ccc(CC(NC(=O)/C=C/CC(O)[C@H](C)/C=C/c2ccccc2)C(=O)OCC(Cl)(Cl)Cl)cc1Cl |
| InChI | InChI=1S/C27H29Cl4NO5/c1-18(11-12-19-7-4-3-5-8-19)23(33)9-6-10-25(34)32-22(26(35)37-17-27(29,30)31)16-20-13-14-24(36-2)21(28)15-20/h3-8,10-15,18,22-23,33H,9,16-17H2,1-2H3,(H,32,34)/b10-6+,12-11+/t18-,22?,23?/m1/s1 |
| InChIKey | UXLOXAFKTOAZSO-OKWNKITQSA-N |
| XLogP | 5.95 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.34 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|