C22H24Cl2O8 — CID 91056807
(3R,6S)-1,8-bis(3-chloro-4-methoxyphenyl)-2,3,6,7-tetrahydroxyoctane-4,5-dione (PubChem CID 91056807) has the molecular formula C22H24Cl2O8 and a molecular weight of 487.33 g/mol. Its IUPAC name is (3R,6S)-1,8-bis(3-chloro-4-methoxyphenyl)-2,3,6,7-tetrahydroxyoctane-4,5-dione.
| Compound Name | (3R,6S)-1,8-bis(3-chloro-4-methoxyphenyl)-2,3,6,7-tetrahydroxyoctane-4,5-dione |
|---|---|
| PubChem CID | 91056807 |
| Molecular Formula | C22H24Cl2O8 |
| Molecular Weight | 487.33 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | (3R,6S)-1,8-bis(3-chloro-4-methoxyphenyl)-2,3,6,7-tetrahydroxyoctane-4,5-dione |
| SMILES | COc1ccc(CC(O)[C@H](O)C(=O)C(=O)[C@H](O)C(O)Cc2ccc(OC)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C22H24Cl2O8/c1-31-17-5-3-11(7-13(17)23)9-15(25)19(27)21(29)22(30)20(28)16(26)10-12-4-6-18(32-2)14(24)8-12/h3-8,15-16,19-20,25-28H,9-10H2,1-2H3/t15?,16?,19-,20+ |
| InChIKey | AKFIJAZGYCXTKU-BIUPVWIKSA-N |
| XLogP | 1.38 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|