C10H11ClO2S — CID 58139123
1-(3-chloro-4-methoxyphenyl)-3-sulfanylpropan-2-one (PubChem CID 58139123) has the molecular formula C10H11ClO2S and a molecular weight of 230.72 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-3-sulfanylpropan-2-one.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-3-sulfanylpropan-2-one |
|---|---|
| PubChem CID | 58139123 |
| Molecular Formula | C10H11ClO2S |
| Molecular Weight | 230.72 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-3-sulfanylpropan-2-one |
| SMILES | COc1ccc(CC(=O)CS)cc1Cl |
| InChI | InChI=1S/C10H11ClO2S/c1-13-10-3-2-7(5-9(10)11)4-8(12)6-14/h2-3,5,14H,4,6H2,1H3 |
| InChIKey | CVWDPYDNPZYXKX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.72 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|