C12H14ClNO5 — CID 65065887
2-[carboxymethyl-[(3-chloro-4-methoxyphenyl)methyl]amino]acetic acid (PubChem CID 65065887) has the molecular formula C12H14ClNO5 and a molecular weight of 287.70 g/mol. Its IUPAC name is 2-[carboxymethyl-[(3-chloro-4-methoxyphenyl)methyl]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[(3-chloro-4-methoxyphenyl)methyl]amino]acetic acid |
|---|---|
| PubChem CID | 65065887 |
| Molecular Formula | C12H14ClNO5 |
| Molecular Weight | 287.70 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 2-[carboxymethyl-[(3-chloro-4-methoxyphenyl)methyl]amino]acetic acid |
| SMILES | COc1ccc(CN(CC(=O)O)CC(=O)O)cc1Cl |
| InChI | InChI=1S/C12H14ClNO5/c1-19-10-3-2-8(4-9(10)13)5-14(6-11(15)16)7-12(17)18/h2-4H,5-7H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | ZKKWRGNBLOUXQX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.70 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |