C15H19ClN2O3 — CID 123208959
3-(3-chloro-4-methoxyphenyl)-N-ethyl-2-(prop-2-enoylamino)propanamide (PubChem CID 123208959) has the molecular formula C15H19ClN2O3 and a molecular weight of 310.78 g/mol. Its IUPAC name is 3-(3-chloro-4-methoxyphenyl)-N-ethyl-2-(prop-2-enoylamino)propanamide.
| Compound Name | 3-(3-chloro-4-methoxyphenyl)-N-ethyl-2-(prop-2-enoylamino)propanamide |
|---|---|
| PubChem CID | 123208959 |
| Molecular Formula | C15H19ClN2O3 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 3-(3-chloro-4-methoxyphenyl)-N-ethyl-2-(prop-2-enoylamino)propanamide |
| SMILES | C=CC(=O)NC(Cc1ccc(OC)c(Cl)c1)C(=O)NCC |
| InChI | InChI=1S/C15H19ClN2O3/c1-4-14(19)18-12(15(20)17-5-2)9-10-6-7-13(21-3)11(16)8-10/h4,6-8,12H,1,5,9H2,2-3H3,(H,17,20)(H,18,19) |
| InChIKey | AKCMBCGSFUXMQI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|