C14H16ClNO4 — CID 164901677
methyl (2R)-3-(3-chloro-4-methoxyphenyl)-2-(prop-2-enoylamino)propanoate (PubChem CID 164901677) has the molecular formula C14H16ClNO4 and a molecular weight of 297.74 g/mol. Its IUPAC name is methyl (2R)-3-(3-chloro-4-methoxyphenyl)-2-(prop-2-enoylamino)propanoate.
| Compound Name | methyl (2R)-3-(3-chloro-4-methoxyphenyl)-2-(prop-2-enoylamino)propanoate |
|---|---|
| PubChem CID | 164901677 |
| Molecular Formula | C14H16ClNO4 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | methyl (2R)-3-(3-chloro-4-methoxyphenyl)-2-(prop-2-enoylamino)propanoate |
| SMILES | C=CC(=O)N[C@H](Cc1ccc(OC)c(Cl)c1)C(=O)OC |
| InChI | InChI=1S/C14H16ClNO4/c1-4-13(17)16-11(14(18)20-3)8-9-5-6-12(19-2)10(15)7-9/h4-7,11H,1,8H2,2-3H3,(H,16,17)/t11-/m1/s1 |
| InChIKey | QOJKCOGAFFPBTA-LLVKDONJSA-N |
| XLogP | 1.73 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|