C13H14O3 — CID 162860051
(2Z,5S,6E)-5-hydroxy-7-phenylhepta-2,6-dienoic acid (PubChem CID 162860051) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is (2Z,5S,6E)-5-hydroxy-7-phenylhepta-2,6-dienoic acid.
| Compound Name | (2Z,5S,6E)-5-hydroxy-7-phenylhepta-2,6-dienoic acid |
|---|---|
| PubChem CID | 162860051 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (2Z,5S,6E)-5-hydroxy-7-phenylhepta-2,6-dienoic acid |
| SMILES | O=C(O)/C=C\C[C@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C13H14O3/c14-12(7-4-8-13(15)16)10-9-11-5-2-1-3-6-11/h1-6,8-10,12,14H,7H2,(H,15,16)/b8-4-,10-9+/t12-/m0/s1 |
| InChIKey | HZIQVOBBWHKQIJ-SJWGIUBASA-N |
| XLogP | 2.09 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|