About (2,5-dioxopyrrolidin-1-yl) (2R,3S)-3-acetyloxy-2-phenylbutanoate
(2,5-dioxopyrrolidin-1-yl) (2R,3S)-3-acetyloxy-2-phenylbutanoate (PubChem CID 129177137) has the molecular formula C16H17NO6
and a molecular weight of 319.31 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (2R,3S)-3-acetyloxy-2-phenylbutanoate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (2R,3S)-3-acetyloxy-2-phenylbutanoate |
| PubChem CID | 129177137 |
| Molecular Formula | C16H17NO6 |
| Molecular Weight | 319.31 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2R,3S)-3-acetyloxy-2-phenylbutanoate |
| SMILES | CC(=O)O[C@@H](C)[C@H](C(=O)ON1C(=O)CCC1=O)c1ccccc1 |
| InChI | InChI=1S/C16H17NO6/c1-10(22-11(2)18)15(12-6-4-3-5-7-12)16(21)23-17-13(19)8-9-14(17)20/h3-7,10,15H,8-9H2,1-2H3/t10-,15-/m0/s1 |
| InChIKey | KOULSOVCGGTAIU-BONVTDFDSA-N |
| XLogP | 1.33 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) (2R,3S)-3-acetyloxy-2-phenylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) (2R,3S)-3-acetyloxy-2-phenylbutanoate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) (2R,3S)-3-acetyloxy-2-phenylbutanoate (CID 129177137) is (2,5-dioxopyrrolidin-1-yl) (2R,3S)-3-acetyloxy-2-phenylbutanoate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) (2R,3S)-3-acetyloxy-2-phenylbutanoate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) (2R,3S)-3-acetyloxy-2-phenylbutanoate is CC(=O)O[C@@H](C)[C@H](C(=O)ON1C(=O)CCC1=O)c1ccccc1.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) (2R,3S)-3-acetyloxy-2-phenylbutanoate?
The InChIKey is KOULSOVCGGTAIU-BONVTDFDSA-N. The full InChI is InChI=1S/C16H17NO6/c1-10(22-11(2)18)15(12-6-4-3-5-7-12)16(21)23-17-13(19)8-9-14(17)20/h3-7,10,15H,8-9H2,1-2H3/t10-,15-/m0/s1.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) (2R,3S)-3-acetyloxy-2-phenylbutanoate?
(2,5-dioxopyrrolidin-1-yl) (2R,3S)-3-acetyloxy-2-phenylbutanoate has a molecular weight of 319.31 g/mol, XLogP of 1.33, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) (2R,3S)-3-acetyloxy-2-phenylbutanoate is sourced from PubChem (CID 129177137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).