C24H27NO12 — CID 129184066
1-O-[(1R)-2-butoxy-2-oxo-1-phenylethyl] 4-O-(2,5-dioxopyrrolidin-1-yl) (2R,3R)-2,3-diacetyloxybutanedioate (PubChem CID 129184066) has the molecular formula C24H27NO12 and a molecular weight of 521.48 g/mol. Its IUPAC name is 1-O-[(1R)-2-butoxy-2-oxo-1-phenylethyl] 4-O-(2,5-dioxopyrrolidin-1-yl) (2R,3R)-2,3-diacetyloxybutanedioate.
| Compound Name | 1-O-[(1R)-2-butoxy-2-oxo-1-phenylethyl] 4-O-(2,5-dioxopyrrolidin-1-yl) (2R,3R)-2,3-diacetyloxybutanedioate |
|---|---|
| PubChem CID | 129184066 |
| Molecular Formula | C24H27NO12 |
| Molecular Weight | 521.48 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | 1-O-[(1R)-2-butoxy-2-oxo-1-phenylethyl] 4-O-(2,5-dioxopyrrolidin-1-yl) (2R,3R)-2,3-diacetyloxybutanedioate |
| SMILES | CCCCOC(=O)[C@H](OC(=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C(=O)ON1C(=O)CCC1=O)c1ccccc1 |
| InChI | InChI=1S/C24H27NO12/c1-4-5-13-33-22(30)19(16-9-7-6-8-10-16)36-23(31)20(34-14(2)26)21(35-15(3)27)24(32)37-25-17(28)11-12-18(25)29/h6-10,19-21H,4-5,11-13H2,1-3H3/t19-,20-,21-/m1/s1 |
| InChIKey | JTVPMQLEAYUEPF-NJDAHSKKSA-N |
| XLogP | 1.08 |
| TPSA | 168.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.48 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|