C20H26N2O5 — CID 87186199
(2,5-dioxopyrrolidin-1-yl) 2-(4-aminophenyl)-3-oxodecanoate (PubChem CID 87186199) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-(4-aminophenyl)-3-oxodecanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-(4-aminophenyl)-3-oxodecanoate |
|---|---|
| PubChem CID | 87186199 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-(4-aminophenyl)-3-oxodecanoate |
| SMILES | CCCCCCCC(=O)C(C(=O)ON1C(=O)CCC1=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C20H26N2O5/c1-2-3-4-5-6-7-16(23)19(14-8-10-15(21)11-9-14)20(26)27-22-17(24)12-13-18(22)25/h8-11,19H,2-7,12-13,21H2,1H3 |
| InChIKey | YKMDGFFJSFWXFR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|