C17H23NO4S — CID 3087426
5-pentoxy-1-(2-phenylethenylsulfonyl)pyrrolidin-2-one (PubChem CID 3087426) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is 5-pentoxy-1-(2-phenylethenylsulfonyl)pyrrolidin-2-one.
| Compound Name | 5-pentoxy-1-(2-phenylethenylsulfonyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 3087426 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 5-pentoxy-1-(2-phenylethenylsulfonyl)pyrrolidin-2-one |
| SMILES | CCCCCOC1CCC(=O)N1S(=O)(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C17H23NO4S/c1-2-3-7-13-22-17-11-10-16(19)18(17)23(20,21)14-12-15-8-5-4-6-9-15/h4-6,8-9,12,14,17H,2-3,7,10-11,13H2,1H3 |
| InChIKey | XYPQOINYDUCKGS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|