C17H17NO2S — CID 6212461
2-methyl-1-[(E)-2-phenylethenyl]sulfonyl-2,3-dihydroindole (PubChem CID 6212461) has the molecular formula C17H17NO2S and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-methyl-1-[(E)-2-phenylethenyl]sulfonyl-2,3-dihydroindole.
| Compound Name | 2-methyl-1-[(E)-2-phenylethenyl]sulfonyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 6212461 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 2-methyl-1-[(E)-2-phenylethenyl]sulfonyl-2,3-dihydroindole |
| SMILES | CC1Cc2ccccc2N1S(=O)(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H17NO2S/c1-14-13-16-9-5-6-10-17(16)18(14)21(19,20)12-11-15-7-3-2-4-8-15/h2-12,14H,13H2,1H3/b12-11+ |
| InChIKey | NQDWVDDGTBGMNW-VAWYXSNFSA-N |
| XLogP | 3.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |