C17H16N2O2S — CID 41037225
4-[[(2R)-2-methyl-2,3-dihydroindol-1-yl]sulfonylmethyl]benzonitrile (PubChem CID 41037225) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is 4-[[(2R)-2-methyl-2,3-dihydroindol-1-yl]sulfonylmethyl]benzonitrile.
| Compound Name | 4-[[(2R)-2-methyl-2,3-dihydroindol-1-yl]sulfonylmethyl]benzonitrile |
|---|---|
| PubChem CID | 41037225 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 4-[[(2R)-2-methyl-2,3-dihydroindol-1-yl]sulfonylmethyl]benzonitrile |
| SMILES | C[C@@H]1Cc2ccccc2N1S(=O)(=O)Cc1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H16N2O2S/c1-13-10-16-4-2-3-5-17(16)19(13)22(20,21)12-15-8-6-14(11-18)7-9-15/h2-9,13H,10,12H2,1H3/t13-/m1/s1 |
| InChIKey | GNINDMFRWAEKDV-CYBMUJFWSA-N |
| XLogP | 2.84 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |