C21H32NOSSi+ — CID 102075272
triethyl-[(E)-3-phenyl-1-(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)prop-2-enoxy]silane (PubChem CID 102075272) has the molecular formula C21H32NOSSi+ and a molecular weight of 374.65 g/mol. Its IUPAC name is triethyl-[(E)-3-phenyl-1-(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)prop-2-enoxy]silane.
| Compound Name | triethyl-[(E)-3-phenyl-1-(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)prop-2-enoxy]silane |
|---|---|
| PubChem CID | 102075272 |
| Molecular Formula | C21H32NOSSi+ |
| Molecular Weight | 374.65 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | triethyl-[(E)-3-phenyl-1-(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)prop-2-enoxy]silane |
| SMILES | CC[Si](CC)(CC)OC(/C=C/c1ccccc1)c1sc(C)c(C)[n+]1C |
| InChI | InChI=1S/C21H32NOSSi/c1-7-25(8-2,9-3)23-20(16-15-19-13-11-10-12-14-19)21-22(6)17(4)18(5)24-21/h10-16,20H,7-9H2,1-6H3/q+1/b16-15+ |
| InChIKey | PEIBQMBGQRKTHW-FOCLMDBBSA-N |
| XLogP | 5.97 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.65 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|