C20H32OSi — CID 139253708
[(E)-4-ethenyl-6-phenylhex-5-enoxy]-triethylsilane (PubChem CID 139253708) has the molecular formula C20H32OSi and a molecular weight of 316.56 g/mol. Its IUPAC name is [(E)-4-ethenyl-6-phenylhex-5-enoxy]-triethylsilane.
| Compound Name | [(E)-4-ethenyl-6-phenylhex-5-enoxy]-triethylsilane |
|---|---|
| PubChem CID | 139253708 |
| Molecular Formula | C20H32OSi |
| Molecular Weight | 316.56 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | [(E)-4-ethenyl-6-phenylhex-5-enoxy]-triethylsilane |
| SMILES | C=CC(/C=C/c1ccccc1)CCCO[Si](CC)(CC)CC |
| InChI | InChI=1S/C20H32OSi/c1-5-19(16-17-20-13-10-9-11-14-20)15-12-18-21-22(6-2,7-3)8-4/h5,9-11,13-14,16-17,19H,1,6-8,12,15,18H2,2-4H3/b17-16+ |
| InChIKey | OHHRQNIBMMFYGK-WUKNDPDISA-N |
| XLogP | 6.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.56 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|