C21H18O — CID 11289166
[(E)-1,3-diphenylprop-2-enoxy]benzene (PubChem CID 11289166) has the molecular formula C21H18O and a molecular weight of 286.37 g/mol. Its IUPAC name is [(E)-1,3-diphenylprop-2-enoxy]benzene.
| Compound Name | [(E)-1,3-diphenylprop-2-enoxy]benzene |
|---|---|
| PubChem CID | 11289166 |
| Molecular Formula | C21H18O |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | [(E)-1,3-diphenylprop-2-enoxy]benzene |
| SMILES | C(=C/C(Oc1ccccc1)c1ccccc1)\c1ccccc1 |
| InChI | InChI=1S/C21H18O/c1-4-10-18(11-5-1)16-17-21(19-12-6-2-7-13-19)22-20-14-8-3-9-15-20/h1-17,21H/b17-16+ |
| InChIKey | CGNHLTXLXIQUEB-WUKNDPDISA-N |
| XLogP | 5.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |