About 2-[[(E,1R)-1,3-diphenylprop-2-enoxy]methyl]thiophene
2-[[(E,1R)-1,3-diphenylprop-2-enoxy]methyl]thiophene (PubChem CID 102292544) has the molecular formula C20H18OS
and a molecular weight of 306.43 g/mol. Its IUPAC name is 2-[[(E,1R)-1,3-diphenylprop-2-enoxy]methyl]thiophene.
Molecular Properties
| Compound Name | 2-[[(E,1R)-1,3-diphenylprop-2-enoxy]methyl]thiophene |
| PubChem CID | 102292544 |
| Molecular Formula | C20H18OS |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 2-[[(E,1R)-1,3-diphenylprop-2-enoxy]methyl]thiophene |
| SMILES | C(=C/[C@@H](OCc1cccs1)c1ccccc1)\c1ccccc1 |
| InChI | InChI=1S/C20H18OS/c1-3-8-17(9-4-1)13-14-20(18-10-5-2-6-11-18)21-16-19-12-7-15-22-19/h1-15,20H,16H2/b14-13+/t20-/m1/s1 |
| InChIKey | SEDDMCYESOVSPK-FBRRREGBSA-N |
| XLogP | 5.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[[(E,1R)-1,3-diphenylprop-2-enoxy]methyl]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(E,1R)-1,3-diphenylprop-2-enoxy]methyl]thiophene?
The IUPAC name of 2-[[(E,1R)-1,3-diphenylprop-2-enoxy]methyl]thiophene (CID 102292544) is 2-[[(E,1R)-1,3-diphenylprop-2-enoxy]methyl]thiophene.
What is the SMILES notation for 2-[[(E,1R)-1,3-diphenylprop-2-enoxy]methyl]thiophene?
The canonical SMILES for 2-[[(E,1R)-1,3-diphenylprop-2-enoxy]methyl]thiophene is C(=C/[C@@H](OCc1cccs1)c1ccccc1)\c1ccccc1.
What is the InChIKey of 2-[[(E,1R)-1,3-diphenylprop-2-enoxy]methyl]thiophene?
The InChIKey is SEDDMCYESOVSPK-FBRRREGBSA-N. The full InChI is InChI=1S/C20H18OS/c1-3-8-17(9-4-1)13-14-20(18-10-5-2-6-11-18)21-16-19-12-7-15-22-19/h1-15,20H,16H2/b14-13+/t20-/m1/s1.
What are the key properties of 2-[[(E,1R)-1,3-diphenylprop-2-enoxy]methyl]thiophene?
2-[[(E,1R)-1,3-diphenylprop-2-enoxy]methyl]thiophene has a molecular weight of 306.43 g/mol, XLogP of 5.72, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(E,1R)-1,3-diphenylprop-2-enoxy]methyl]thiophene is sourced from PubChem (CID 102292544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).