C20H18OS — CID 102292544
2-[[(E,1R)-1,3-diphenylprop-2-enoxy]methyl]thiophene (PubChem CID 102292544) has the molecular formula C20H18OS and a molecular weight of 306.43 g/mol. Its IUPAC name is 2-[[(E,1R)-1,3-diphenylprop-2-enoxy]methyl]thiophene.
| Compound Name | 2-[[(E,1R)-1,3-diphenylprop-2-enoxy]methyl]thiophene |
|---|---|
| PubChem CID | 102292544 |
| Molecular Formula | C20H18OS |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 2-[[(E,1R)-1,3-diphenylprop-2-enoxy]methyl]thiophene |
| SMILES | C(=C/[C@@H](OCc1cccs1)c1ccccc1)\c1ccccc1 |
| InChI | InChI=1S/C20H18OS/c1-3-8-17(9-4-1)13-14-20(18-10-5-2-6-11-18)21-16-19-12-7-15-22-19/h1-15,20H,16H2/b14-13+/t20-/m1/s1 |
| InChIKey | SEDDMCYESOVSPK-FBRRREGBSA-N |
| XLogP | 5.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |