C35H36N2 — CID 46784067
1-benzhydryl-4-[(1E,5E)-1,6-diphenylhexa-1,5-dien-3-yl]piperazine (PubChem CID 46784067) has the molecular formula C35H36N2 and a molecular weight of 484.69 g/mol. Its IUPAC name is 1-benzhydryl-4-[(1E,5E)-1,6-diphenylhexa-1,5-dien-3-yl]piperazine.
| Compound Name | 1-benzhydryl-4-[(1E,5E)-1,6-diphenylhexa-1,5-dien-3-yl]piperazine |
|---|---|
| PubChem CID | 46784067 |
| Molecular Formula | C35H36N2 |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | 1-benzhydryl-4-[(1E,5E)-1,6-diphenylhexa-1,5-dien-3-yl]piperazine |
| SMILES | C(=C/c1ccccc1)\CC(/C=C/c1ccccc1)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C35H36N2/c1-5-14-30(15-6-1)18-13-23-34(25-24-31-16-7-2-8-17-31)36-26-28-37(29-27-36)35(32-19-9-3-10-20-32)33-21-11-4-12-22-33/h1-22,24-25,34-35H,23,26-29H2/b18-13+,25-24+ |
| InChIKey | FFKBIJDNNHKVGD-KNWAISMVSA-N |
| XLogP | 7.58 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |