C31H40ClN2O4P — CID 11801192
[4-benzhydryl-1-[(E)-3-phenylprop-2-enyl]piperazin-1-ium-1-yl]methyl tert-butyl hydrogen phosphate chloride (PubChem CID 11801192) has the molecular formula C31H40ClN2O4P and a molecular weight of 571.10 g/mol. Its IUPAC name is [4-benzhydryl-1-[(E)-3-phenylprop-2-enyl]piperazin-1-ium-1-yl]methyl tert-butyl hydrogen phosphate chloride.
| Compound Name | [4-benzhydryl-1-[(E)-3-phenylprop-2-enyl]piperazin-1-ium-1-yl]methyl tert-butyl hydrogen phosphate chloride |
|---|---|
| PubChem CID | 11801192 |
| Molecular Formula | C31H40ClN2O4P |
| Molecular Weight | 571.10 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | [4-benzhydryl-1-[(E)-3-phenylprop-2-enyl]piperazin-1-ium-1-yl]methyl tert-butyl hydrogen phosphate chloride |
| SMILES | CC(C)(C)OP(=O)(O)OC[N+]1(C/C=C/c2ccccc2)CCN(C(c2ccccc2)c2ccccc2)CC1.[Cl-] |
| InChI | InChI=1S/C31H39N2O4P.ClH/c1-31(2,3)37-38(34,35)36-26-33(23-13-16-27-14-7-4-8-15-27)24-21-32(22-25-33)30(28-17-9-5-10-18-28)29-19-11-6-12-20-29;/h4-20,30H,21-26H2,1-3H3;1H/b16-13+; |
| InChIKey | FEEZBCUHXDOPLI-ZUQRMPMESA-N |
| XLogP | 3.52 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.10 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|