C23H30N2O — CID 52894453
1-(4-benzhydrylpiperazin-1-yl)-3,3-dimethylbutan-1-one (PubChem CID 52894453) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is 1-(4-benzhydrylpiperazin-1-yl)-3,3-dimethylbutan-1-one.
| Compound Name | 1-(4-benzhydrylpiperazin-1-yl)-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 52894453 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 1-(4-benzhydrylpiperazin-1-yl)-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)CC(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C23H30N2O/c1-23(2,3)18-21(26)24-14-16-25(17-15-24)22(19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-13,22H,14-18H2,1-3H3 |
| InChIKey | QHEUVBNWVJTYAN-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |