C33H35AsN2O — CID 173160090
2-arsanyl-1-(4-benzhydrylpiperazin-1-yl)-2-methyl-3,3-diphenylpropan-1-one (PubChem CID 173160090) has the molecular formula C33H35AsN2O and a molecular weight of 550.58 g/mol. Its IUPAC name is 2-arsanyl-1-(4-benzhydrylpiperazin-1-yl)-2-methyl-3,3-diphenylpropan-1-one.
| Compound Name | 2-arsanyl-1-(4-benzhydrylpiperazin-1-yl)-2-methyl-3,3-diphenylpropan-1-one |
|---|---|
| PubChem CID | 173160090 |
| Molecular Formula | C33H35AsN2O |
| Molecular Weight | 550.58 g/mol |
| Exact Mass | 550.20 |
| IUPAC Name | 2-arsanyl-1-(4-benzhydrylpiperazin-1-yl)-2-methyl-3,3-diphenylpropan-1-one |
| SMILES | CC([AsH2])(C(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H35AsN2O/c1-33(34,30(26-14-6-2-7-15-26)27-16-8-3-9-17-27)32(37)36-24-22-35(23-25-36)31(28-18-10-4-11-19-28)29-20-12-5-13-21-29/h2-21,30-31H,22-25,34H2,1H3 |
| InChIKey | BKFSJWSIAZCCFT-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.58 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|