C22H31IN2 — CID 3030334
1,1-diethyl-4-[(3-methylphenyl)-phenylmethyl]piperazin-1-ium iodide (PubChem CID 3030334) has the molecular formula C22H31IN2 and a molecular weight of 450.41 g/mol. Its IUPAC name is 1,1-diethyl-4-[(3-methylphenyl)-phenylmethyl]piperazin-1-ium iodide.
| Compound Name | 1,1-diethyl-4-[(3-methylphenyl)-phenylmethyl]piperazin-1-ium iodide |
|---|---|
| PubChem CID | 3030334 |
| Molecular Formula | C22H31IN2 |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 1,1-diethyl-4-[(3-methylphenyl)-phenylmethyl]piperazin-1-ium iodide |
| SMILES | CC[N+]1(CC)CCN(C(c2ccccc2)c2cccc(C)c2)CC1.[I-] |
| InChI | InChI=1S/C22H31N2.HI/c1-4-24(5-2)16-14-23(15-17-24)22(20-11-7-6-8-12-20)21-13-9-10-19(3)18-21;/h6-13,18,22H,4-5,14-17H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | WYEXMZNKLJEIFU-UHFFFAOYSA-M |
| XLogP | 1.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|