C20H27N2+ — CID 3030341
1,1-dimethyl-4-[(3-methylphenyl)-phenylmethyl]piperazin-1-ium (PubChem CID 3030341) has the molecular formula C20H27N2+ and a molecular weight of 295.45 g/mol. Its IUPAC name is 1,1-dimethyl-4-[(3-methylphenyl)-phenylmethyl]piperazin-1-ium.
| Compound Name | 1,1-dimethyl-4-[(3-methylphenyl)-phenylmethyl]piperazin-1-ium |
|---|---|
| PubChem CID | 3030341 |
| Molecular Formula | C20H27N2+ |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.22 |
| IUPAC Name | 1,1-dimethyl-4-[(3-methylphenyl)-phenylmethyl]piperazin-1-ium |
| SMILES | Cc1cccc(C(c2ccccc2)N2CC[N+](C)(C)CC2)c1 |
| InChI | InChI=1S/C20H27N2/c1-17-8-7-11-19(16-17)20(18-9-5-4-6-10-18)21-12-14-22(2,3)15-13-21/h4-11,16,20H,12-15H2,1-3H3/q+1 |
| InChIKey | HMPHHTIFLAJIOR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|