C13H21IN2 — CID 11099608
1,1-dimethyl-4-(3-methylphenyl)piperazin-1-ium iodide (PubChem CID 11099608) has the molecular formula C13H21IN2 and a molecular weight of 332.23 g/mol. Its IUPAC name is 1,1-dimethyl-4-(3-methylphenyl)piperazin-1-ium iodide.
| Compound Name | 1,1-dimethyl-4-(3-methylphenyl)piperazin-1-ium iodide |
|---|---|
| PubChem CID | 11099608 |
| Molecular Formula | C13H21IN2 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 1,1-dimethyl-4-(3-methylphenyl)piperazin-1-ium iodide |
| SMILES | Cc1cccc(N2CC[N+](C)(C)CC2)c1.[I-] |
| InChI | InChI=1S/C13H21N2.HI/c1-12-5-4-6-13(11-12)14-7-9-15(2,3)10-8-14;/h4-6,11H,7-10H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | GLEANDRHEIJXAS-UHFFFAOYSA-M |
| XLogP | -1.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|