C16H26N2O — CID 55055417
2,2-dimethyl-3-[4-(3-methylphenyl)piperazin-1-yl]propan-1-ol (PubChem CID 55055417) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is 2,2-dimethyl-3-[4-(3-methylphenyl)piperazin-1-yl]propan-1-ol.
| Compound Name | 2,2-dimethyl-3-[4-(3-methylphenyl)piperazin-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 55055417 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 2,2-dimethyl-3-[4-(3-methylphenyl)piperazin-1-yl]propan-1-ol |
| SMILES | Cc1cccc(N2CCN(CC(C)(C)CO)CC2)c1 |
| InChI | InChI=1S/C16H26N2O/c1-14-5-4-6-15(11-14)18-9-7-17(8-10-18)12-16(2,3)13-19/h4-6,11,19H,7-10,12-13H2,1-3H3 |
| InChIKey | DIQMLBKFDJRLNY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |