C21H28ClIN2 — CID 3030300
4-[(4-chlorophenyl)-phenylmethyl]-1-methyl-1-propan-2-ylpiperazin-1-ium iodide (PubChem CID 3030300) has the molecular formula C21H28ClIN2 and a molecular weight of 470.83 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)-phenylmethyl]-1-methyl-1-propan-2-ylpiperazin-1-ium iodide.
| Compound Name | 4-[(4-chlorophenyl)-phenylmethyl]-1-methyl-1-propan-2-ylpiperazin-1-ium iodide |
|---|---|
| PubChem CID | 3030300 |
| Molecular Formula | C21H28ClIN2 |
| Molecular Weight | 470.83 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | 4-[(4-chlorophenyl)-phenylmethyl]-1-methyl-1-propan-2-ylpiperazin-1-ium iodide |
| SMILES | CC(C)[N+]1(C)CCN(C(c2ccccc2)c2ccc(Cl)cc2)CC1.[I-] |
| InChI | InChI=1S/C21H28ClN2.HI/c1-17(2)24(3)15-13-23(14-16-24)21(18-7-5-4-6-8-18)19-9-11-20(22)12-10-19;/h4-12,17,21H,13-16H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | PZLQZSYBWGWCBG-UHFFFAOYSA-M |
| XLogP | 1.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.83 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|