C20H31IN2 — CID 24842355
4-[cyclohexen-1-yl(phenyl)methyl]-1-ethyl-1-methylpiperazin-1-ium iodide (PubChem CID 24842355) has the molecular formula C20H31IN2 and a molecular weight of 426.39 g/mol. Its IUPAC name is 4-[cyclohexen-1-yl(phenyl)methyl]-1-ethyl-1-methylpiperazin-1-ium iodide.
| Compound Name | 4-[cyclohexen-1-yl(phenyl)methyl]-1-ethyl-1-methylpiperazin-1-ium iodide |
|---|---|
| PubChem CID | 24842355 |
| Molecular Formula | C20H31IN2 |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 4-[cyclohexen-1-yl(phenyl)methyl]-1-ethyl-1-methylpiperazin-1-ium iodide |
| SMILES | CC[N+]1(C)CCN(C(C2=CCCCC2)c2ccccc2)CC1.[I-] |
| InChI | InChI=1S/C20H31N2.HI/c1-3-22(2)16-14-21(15-17-22)20(18-10-6-4-7-11-18)19-12-8-5-9-13-19;/h4,6-7,10-12,20H,3,5,8-9,13-17H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | SDVCQKMCPCTLFD-UHFFFAOYSA-M |
| XLogP | 1.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|