C18H22ClN — CID 91365879
1-[(4-chlorophenyl)-(cyclohexen-1-yl)methyl]-3,6-dihydro-2H-pyridine (PubChem CID 91365879) has the molecular formula C18H22ClN and a molecular weight of 287.83 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)-(cyclohexen-1-yl)methyl]-3,6-dihydro-2H-pyridine.
| Compound Name | 1-[(4-chlorophenyl)-(cyclohexen-1-yl)methyl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 91365879 |
| Molecular Formula | C18H22ClN |
| Molecular Weight | 287.83 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 1-[(4-chlorophenyl)-(cyclohexen-1-yl)methyl]-3,6-dihydro-2H-pyridine |
| SMILES | Clc1ccc(C(C2=CCCCC2)N2CC=CCC2)cc1 |
| InChI | InChI=1S/C18H22ClN/c19-17-11-9-16(10-12-17)18(15-7-3-1-4-8-15)20-13-5-2-6-14-20/h2,5,7,9-12,18H,1,3-4,6,8,13-14H2 |
| InChIKey | QXNRQQRNUXWXJL-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.83 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|