C21H28ClN2+ — CID 3030285
4-[(2-chlorophenyl)-phenylmethyl]-1,1-diethylpiperazin-1-ium (PubChem CID 3030285) has the molecular formula C21H28ClN2+ and a molecular weight of 343.92 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)-phenylmethyl]-1,1-diethylpiperazin-1-ium.
| Compound Name | 4-[(2-chlorophenyl)-phenylmethyl]-1,1-diethylpiperazin-1-ium |
|---|---|
| PubChem CID | 3030285 |
| Molecular Formula | C21H28ClN2+ |
| Molecular Weight | 343.92 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 4-[(2-chlorophenyl)-phenylmethyl]-1,1-diethylpiperazin-1-ium |
| SMILES | CC[N+]1(CC)CCN(C(c2ccccc2)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C21H28ClN2/c1-3-24(4-2)16-14-23(15-17-24)21(18-10-6-5-7-11-18)19-12-8-9-13-20(19)22/h5-13,21H,3-4,14-17H2,1-2H3/q+1 |
| InChIKey | PLUPPAGLCIEDKD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.92 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|