C28H23NO — CID 45378873
N-[(E)-1,3-diphenylprop-2-enoxy]-1,1-diphenylmethanimine (PubChem CID 45378873) has the molecular formula C28H23NO and a molecular weight of 389.50 g/mol. Its IUPAC name is N-[(E)-1,3-diphenylprop-2-enoxy]-1,1-diphenylmethanimine.
| Compound Name | N-[(E)-1,3-diphenylprop-2-enoxy]-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 45378873 |
| Molecular Formula | C28H23NO |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | N-[(E)-1,3-diphenylprop-2-enoxy]-1,1-diphenylmethanimine |
| SMILES | C(=C/C(ON=C(c1ccccc1)c1ccccc1)c1ccccc1)\c1ccccc1 |
| InChI | InChI=1S/C28H23NO/c1-5-13-23(14-6-1)21-22-27(24-15-7-2-8-16-24)30-29-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-22,27H/b22-21+ |
| InChIKey | FDQDRZWUVSVOKT-QURGRASLSA-N |
| XLogP | 6.91 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|