About (E)-N-[(E)-1,3-diphenylprop-2-enoxy]-1-(4-methylphenyl)methanimine
(E)-N-[(E)-1,3-diphenylprop-2-enoxy]-1-(4-methylphenyl)methanimine (PubChem CID 45378867) has the molecular formula C23H21NO
and a molecular weight of 327.43 g/mol. Its IUPAC name is (E)-N-[(E)-1,3-diphenylprop-2-enoxy]-1-(4-methylphenyl)methanimine.
Molecular Properties
| Compound Name | (E)-N-[(E)-1,3-diphenylprop-2-enoxy]-1-(4-methylphenyl)methanimine |
| PubChem CID | 45378867 |
| Molecular Formula | C23H21NO |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (E)-N-[(E)-1,3-diphenylprop-2-enoxy]-1-(4-methylphenyl)methanimine |
| SMILES | Cc1ccc(/C=N/OC(/C=C/c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21NO/c1-19-12-14-21(15-13-19)18-24-25-23(22-10-6-3-7-11-22)17-16-20-8-4-2-5-9-20/h2-18,23H,1H3/b17-16+,24-18+ |
| InChIKey | JOMVRUWUMOCPMQ-WAPKBUOOSA-N |
| XLogP | 5.80 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-[(E)-1,3-diphenylprop-2-enoxy]-1-(4-methylphenyl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-[(E)-1,3-diphenylprop-2-enoxy]-1-(4-methylphenyl)methanimine?
The IUPAC name of (E)-N-[(E)-1,3-diphenylprop-2-enoxy]-1-(4-methylphenyl)methanimine (CID 45378867) is (E)-N-[(E)-1,3-diphenylprop-2-enoxy]-1-(4-methylphenyl)methanimine.
What is the SMILES notation for (E)-N-[(E)-1,3-diphenylprop-2-enoxy]-1-(4-methylphenyl)methanimine?
The canonical SMILES for (E)-N-[(E)-1,3-diphenylprop-2-enoxy]-1-(4-methylphenyl)methanimine is Cc1ccc(/C=N/OC(/C=C/c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of (E)-N-[(E)-1,3-diphenylprop-2-enoxy]-1-(4-methylphenyl)methanimine?
The InChIKey is JOMVRUWUMOCPMQ-WAPKBUOOSA-N. The full InChI is InChI=1S/C23H21NO/c1-19-12-14-21(15-13-19)18-24-25-23(22-10-6-3-7-11-22)17-16-20-8-4-2-5-9-20/h2-18,23H,1H3/b17-16+,24-18+.
What are the key properties of (E)-N-[(E)-1,3-diphenylprop-2-enoxy]-1-(4-methylphenyl)methanimine?
(E)-N-[(E)-1,3-diphenylprop-2-enoxy]-1-(4-methylphenyl)methanimine has a molecular weight of 327.43 g/mol, XLogP of 5.80, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-[(E)-1,3-diphenylprop-2-enoxy]-1-(4-methylphenyl)methanimine is sourced from PubChem (CID 45378867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).