C23H21NO — CID 45378867
(E)-N-[(E)-1,3-diphenylprop-2-enoxy]-1-(4-methylphenyl)methanimine (PubChem CID 45378867) has the molecular formula C23H21NO and a molecular weight of 327.43 g/mol. Its IUPAC name is (E)-N-[(E)-1,3-diphenylprop-2-enoxy]-1-(4-methylphenyl)methanimine.
| Compound Name | (E)-N-[(E)-1,3-diphenylprop-2-enoxy]-1-(4-methylphenyl)methanimine |
|---|---|
| PubChem CID | 45378867 |
| Molecular Formula | C23H21NO |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (E)-N-[(E)-1,3-diphenylprop-2-enoxy]-1-(4-methylphenyl)methanimine |
| SMILES | Cc1ccc(/C=N/OC(/C=C/c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21NO/c1-19-12-14-21(15-13-19)18-24-25-23(22-10-6-3-7-11-22)17-16-20-8-4-2-5-9-20/h2-18,23H,1H3/b17-16+,24-18+ |
| InChIKey | JOMVRUWUMOCPMQ-WAPKBUOOSA-N |
| XLogP | 5.80 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|