C22H20O2S — CID 11484850
[(E,1S)-1,3-diphenylprop-2-enyl] 4-methylbenzenesulfinate (PubChem CID 11484850) has the molecular formula C22H20O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is [(E,1S)-1,3-diphenylprop-2-enyl] 4-methylbenzenesulfinate.
| Compound Name | [(E,1S)-1,3-diphenylprop-2-enyl] 4-methylbenzenesulfinate |
|---|---|
| PubChem CID | 11484850 |
| Molecular Formula | C22H20O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | [(E,1S)-1,3-diphenylprop-2-enyl] 4-methylbenzenesulfinate |
| SMILES | Cc1ccc(S(=O)O[C@@H](/C=C/c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H20O2S/c1-18-12-15-21(16-13-18)25(23)24-22(20-10-6-3-7-11-20)17-14-19-8-4-2-5-9-19/h2-17,22H,1H3/b17-14+/t22-,25?/m0/s1 |
| InChIKey | DZDMMFJCYBNWDI-OEQBHIAESA-N |
| XLogP | 5.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |