C17H18N2O3S — CID 11631301
(S)-4-methyl-N-[(E,2S)-1-nitro-4-phenylbut-3-en-2-yl]benzenesulfinamide (PubChem CID 11631301) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is (S)-4-methyl-N-[(E,2S)-1-nitro-4-phenylbut-3-en-2-yl]benzenesulfinamide.
| Compound Name | (S)-4-methyl-N-[(E,2S)-1-nitro-4-phenylbut-3-en-2-yl]benzenesulfinamide |
|---|---|
| PubChem CID | 11631301 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | (S)-4-methyl-N-[(E,2S)-1-nitro-4-phenylbut-3-en-2-yl]benzenesulfinamide |
| SMILES | Cc1ccc([S@](=O)N[C@@H](/C=C/c2ccccc2)C[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H18N2O3S/c1-14-7-11-17(12-8-14)23(22)18-16(13-19(20)21)10-9-15-5-3-2-4-6-15/h2-12,16,18H,13H2,1H3/b10-9+/t16-,23-/m0/s1 |
| InChIKey | WTUQZDAMSZPDCU-KXIKNEGISA-N |
| XLogP | 2.97 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|