C25H25NOS — CID 6440823
N-[(1E)-4-(4-methylphenyl)sulfinyl-1-phenylhexa-1,5-dien-3-yl]aniline (PubChem CID 6440823) has the molecular formula C25H25NOS and a molecular weight of 387.55 g/mol. Its IUPAC name is N-[(1E)-4-(4-methylphenyl)sulfinyl-1-phenylhexa-1,5-dien-3-yl]aniline.
| Compound Name | N-[(1E)-4-(4-methylphenyl)sulfinyl-1-phenylhexa-1,5-dien-3-yl]aniline |
|---|---|
| PubChem CID | 6440823 |
| Molecular Formula | C25H25NOS |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | N-[(1E)-4-(4-methylphenyl)sulfinyl-1-phenylhexa-1,5-dien-3-yl]aniline |
| SMILES | C=CC(C(/C=C/c1ccccc1)Nc1ccccc1)S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H25NOS/c1-3-25(28(27)23-17-14-20(2)15-18-23)24(26-22-12-8-5-9-13-22)19-16-21-10-6-4-7-11-21/h3-19,24-26H,1H2,2H3/b19-16+ |
| InChIKey | ZYWIRDGRADOIPY-KNTRCKAVSA-N |
| XLogP | 5.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|