About N-ethenoxy-1,1-diphenylmethanimine
N-ethenoxy-1,1-diphenylmethanimine (PubChem CID 12982594) has the molecular formula C15H13NO
and a molecular weight of 223.27 g/mol. Its IUPAC name is N-ethenoxy-1,1-diphenylmethanimine.
Molecular Properties
| Compound Name | N-ethenoxy-1,1-diphenylmethanimine |
| PubChem CID | 12982594 |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | N-ethenoxy-1,1-diphenylmethanimine |
| SMILES | C=CON=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H13NO/c1-2-17-16-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h2-12H,1H2 |
| InChIKey | RWNUXFSHGSKWOD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-ethenoxy-1,1-diphenylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenoxy-1,1-diphenylmethanimine?
The IUPAC name of N-ethenoxy-1,1-diphenylmethanimine (CID 12982594) is N-ethenoxy-1,1-diphenylmethanimine.
What is the SMILES notation for N-ethenoxy-1,1-diphenylmethanimine?
The canonical SMILES for N-ethenoxy-1,1-diphenylmethanimine is C=CON=C(c1ccccc1)c1ccccc1.
What is the InChIKey of N-ethenoxy-1,1-diphenylmethanimine?
The InChIKey is RWNUXFSHGSKWOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO/c1-2-17-16-15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h2-12H,1H2.
What are the key properties of N-ethenoxy-1,1-diphenylmethanimine?
N-ethenoxy-1,1-diphenylmethanimine has a molecular weight of 223.27 g/mol, XLogP of 3.60, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenoxy-1,1-diphenylmethanimine is sourced from PubChem (CID 12982594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).