C16H15NO2 — CID 11054172
N-(oxiran-2-ylmethoxy)-1,1-diphenylmethanimine (PubChem CID 11054172) has the molecular formula C16H15NO2 and a molecular weight of 253.30 g/mol. Its IUPAC name is N-(oxiran-2-ylmethoxy)-1,1-diphenylmethanimine.
| Compound Name | N-(oxiran-2-ylmethoxy)-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 11054172 |
| Molecular Formula | C16H15NO2 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-(oxiran-2-ylmethoxy)-1,1-diphenylmethanimine |
| SMILES | c1ccc(C(=NOCC2CO2)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H15NO2/c1-3-7-13(8-4-1)16(14-9-5-2-6-10-14)17-19-12-15-11-18-15/h1-10,15H,11-12H2 |
| InChIKey | AGEKQDWKVCMEMS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 34.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|