C19H23NO — CID 164930301
N-(3,3-dimethylbutoxy)-1,1-diphenylmethanimine (PubChem CID 164930301) has the molecular formula C19H23NO and a molecular weight of 281.40 g/mol. Its IUPAC name is N-(3,3-dimethylbutoxy)-1,1-diphenylmethanimine.
| Compound Name | N-(3,3-dimethylbutoxy)-1,1-diphenylmethanimine |
|---|---|
| PubChem CID | 164930301 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | N-(3,3-dimethylbutoxy)-1,1-diphenylmethanimine |
| SMILES | CC(C)(C)CCON=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H23NO/c1-19(2,3)14-15-21-20-18(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13H,14-15H2,1-3H3 |
| InChIKey | YZRRYTSSJYETHU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|