C16H13NO3 — CID 174665689
(1-oxo-1,4-diphenylbut-3-en-2-yl) nitrite (PubChem CID 174665689) has the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. Its IUPAC name is (1-oxo-1,4-diphenylbut-3-en-2-yl) nitrite.
| Compound Name | (1-oxo-1,4-diphenylbut-3-en-2-yl) nitrite |
|---|---|
| PubChem CID | 174665689 |
| Molecular Formula | C16H13NO3 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | (1-oxo-1,4-diphenylbut-3-en-2-yl) nitrite |
| SMILES | O=NOC(C=Cc1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H13NO3/c18-16(14-9-5-2-6-10-14)15(20-17-19)12-11-13-7-3-1-4-8-13/h1-12,15H |
| InChIKey | UUXFKXLBVULIQF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|